622-98-0 1-Chloro-4-ethylbenzene
| Nome do produto |
1-Chloro-4-ethylbenzene |
| Nome em inglês |
1-Chloro-4-ethylbenzene; p-Ethylchlorobenzene |
| Fórmula molecular |
C8H9Cl |
| Peso Molecular |
140.6101 |
| InChI |
InChI=1/C8H9Cl/c1-2-7-3-5-8(9)6-4-7/h3-6H,2H2,1H3 |
| CAS Registry Number |
622-98-0 |
| EINECS |
210-763-3 |
| Estrutura Molecular |
|
| Densidade |
1.047g/cm3 |
| Ponto de ebuli??o |
184.4°C at 760 mmHg |
| índice de refra??o |
1.518 |
| O ponto de inflama??o |
60°C |
| Press?o de vapor |
1.01mmHg at 25°C |
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|