ChemNet > CAS > 538-62-5 Phenylazoformic acid 2-phenylhydrazide
538-62-5 Phenylazoformic acid 2-phenylhydrazide
| Nome do produto |
Phenylazoformic acid 2-phenylhydrazide |
| Nome em inglês |
Phenylazoformic acid 2-phenylhydrazide; SYM-DIPHENYLCARBAZONE; (E)-N',2-diphenyldiazenecarbohydrazide; Diphenylcarbazone; Diphenyl carbazone |
| Fórmula molecular |
C13H12N4O |
| Peso Molecular |
240.2606 |
| InChI |
InChI=1/C13H12N4O/c18-13(16-14-11-7-3-1-4-8-11)17-15-12-9-5-2-6-10-12/h1-10,14H,(H,16,18)/b17-15- |
| CAS Registry Number |
538-62-5 |
| EINECS |
208-698-0 |
| Estrutura Molecular |
|
| Ponto de fus?o |
153-157℃ |
| índice de refra??o |
1.617 |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|