3085-54-9 4-Methylformanilide
| Nome do produto |
4-Methylformanilide |
| Nome em inglês |
4-Methylformanilide;4'-Methylformanilide; AI3-01418; Formamide, N-(4-methylphenyl)-; N-(4-methylphenyl)formamide |
| Fórmula molecular |
C8H9NO |
| Peso Molecular |
135.1632 |
| InChI |
InChI=1/C8H9NO/c1-7-2-4-8(5-3-7)9-6-10/h2-6H,1H3,(H,9,10) |
| CAS Registry Number |
3085-54-9 |
| EINECS |
221-400-3 |
| Estrutura Molecular |
|
| Densidade |
1.103g/cm3 |
| Ponto de ebuli??o |
293.5°C at 760 mmHg |
| índice de refra??o |
1.581 |
| O ponto de inflama??o |
166.8°C |
| Press?o de vapor |
0.00172mmHg at 25°C |
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|