201058-08-4 Wang resin
| Nome do produto |
Wang resin |
| Nome em inglês |
Wang resin; 4-Benzyloxybenzyl alcohol, polymer-supported~Polystyrene PHB; [4-(Hydroxymethyl)phenoxymethyl]polystyrene divinylbenzene copolymer; {4-[(4-methylbenzyl)oxy]phenyl}methanol |
| Fórmula molecular |
C15H16O2 |
| Peso Molecular |
228.2863 |
| InChI |
InChI=1/C15H16O2/c1-12-2-4-14(5-3-12)11-17-15-8-6-13(10-16)7-9-15/h2-9,16H,10-11H2,1H3 |
| CAS Registry Number |
201058-08-4 |
| Estrutura Molecular |
|
| Densidade |
1.117g/cm3 |
| Ponto de ebuli??o |
386.2°C at 760 mmHg |
| índice de refra??o |
1.587 |
| O ponto de inflama??o |
175.2°C |
| Press?o de vapor |
1.18E-06mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|