1740-57-4 Isophthalamide
| Nome do produto |
Isophthalamide |
| Nome em inglês |
Isophthalamide;1,3-Benzenedicarboxamide; 1-09-00-00372 (Beilstein Handbook Reference); BRN 2045544; Isophthalic acid diamide; m-Carbamoylbenzamide; m-Phthalamide; Isophthaldiamide; benzene-1,3-dicarboxamide |
| Fórmula molecular |
C8H8N2O2 |
| Peso Molecular |
164.1613 |
| InChI |
InChI=1/C8H8N2O2/c9-7(11)5-2-1-3-6(4-5)8(10)12/h1-4H,(H2,9,11)(H2,10,12) |
| CAS Registry Number |
1740-57-4 |
| EINECS |
217-104-9 |
| Estrutura Molecular |
|
| Densidade |
1.294g/cm3 |
| Ponto de ebuli??o |
430.8°C at 760 mmHg |
| índice de refra??o |
1.612 |
| O ponto de inflama??o |
214.4°C |
| Press?o de vapor |
1.26E-07mmHg at 25°C |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|