1732-08-7 Dimethyl pimelate
| Nome do produto |
Dimethyl pimelate |
| Nome em inglês |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
| Fórmula molecular |
C9H16O4 |
| Peso Molecular |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| CAS Registry Number |
1732-08-7 |
| EINECS |
217-057-4 |
| Estrutura Molecular |
|
| Densidade |
1.022g/cm3 |
| Ponto de ebuli??o |
250.3°C at 760 mmHg |
| índice de refra??o |
1.427 |
| O ponto de inflama??o |
105.4°C |
| Press?o de vapor |
0.0219mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|