16205-90-6 Ethyl 2-hexynoate
| Nome do produto |
Ethyl 2-hexynoate |
| Nome em inglês |
Ethyl 2-hexynoate; 2-Hexynoic acid ethyl ester; ethyl hex-2-ynoate |
| Fórmula molecular |
C8H12O2 |
| Peso Molecular |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3-5H2,1-2H3 |
| CAS Registry Number |
16205-90-6 |
| EINECS |
240-335-1 |
| Estrutura Molecular |
|
| Densidade |
0.951g/cm3 |
| Ponto de ebuli??o |
205.1°C at 760 mmHg |
| índice de refra??o |
1.44 |
| O ponto de inflama??o |
76.9°C |
| Press?o de vapor |
0.255mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|