626-04-0 benzene-1,3-dithiol
| Nazwa produktu: |
benzene-1,3-dithiol |
| Angielska nazwa |
benzene-1,3-dithiol; 1,3-Benzenedithiol; 1,3-Dimercaptobenzene~Dithioresorcinol |
| MF |
C6H6S2 |
| Masie cz?steczkowej |
142.2418 |
| InChI |
InChI=1/C6H6S2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
| Nr CAS |
626-04-0 |
| EINECS |
210-925-3 |
| Struktury molekularnej |
|
| G?sto?? |
1.24g/cm3 |
| Temperatura topnienia |
24-25℃ |
| Temperatura wrzenia |
244.3°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.665 |
| Temperatura zap?onu |
112.7°C |
| Ci?nienie pary |
0.0477mmHg at 25°C |
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|