3396-11-0 Cesium acetate
| Nazwa produktu: |
Cesium acetate |
| Angielska nazwa |
Cesium acetate; Cesiumacetatetech; Cesiumacetatelump; Cesium acetate,(99.9% Cs); caesium acetate |
| MF |
C2H3CsO2 |
| Masie cz?steczkowej |
191.9495 |
| InChI |
InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
| Nr CAS |
3396-11-0 |
| EINECS |
222-248-0 |
| Struktury molekularnej |
|
| Temperatura topnienia |
194-195℃ |
| Temperatura wrzenia |
117.1°C at 760 mmHg |
| Temperatura zap?onu |
40°C |
| Ci?nienie pary |
13.9mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|