101-17-7 3-Chlorodiphenylamine
| Nazwa produktu: |
3-Chlorodiphenylamine |
| Angielska nazwa |
3-Chlorodiphenylamine; Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
| MF |
C12H10ClN |
| Masie cz?steczkowej |
203.6675 |
| InChI |
InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| Nr CAS |
101-17-7 |
| EINECS |
202-922-0 |
| Struktury molekularnej |
|
| G?sto?? |
1.216g/cm3 |
| Temperatura wrzenia |
337.8°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.642 |
| Temperatura zap?onu |
147.4°C |
| Ci?nienie pary |
0.000102mmHg at 25°C |
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|