ChemNet > CAS > 9010-77-9 Ethylene/acrylic acid copolymer
9010-77-9 Ethylene/acrylic acid copolymer
| produktnavn |
Ethylene/acrylic acid copolymer |
| Engelsk navn |
Ethylene/acrylic acid copolymer; Poly(ethylene-co-acrylic acid); Ethylene-acrylic acid resin (90/10; prop-2-enoic acid - ethene (1:1); Ethylene acrylic acid copolymer; EAA |
| Molekyl?r Formel |
C5H8O2 |
| Molekylvekt |
100.1158 |
| InChI |
InChI=1/C3H4O2.C2H4/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H2 |
| CAS-nummer |
9010-77-9 |
| Molecular Structure |
|
| Smeltepunkt |
87-101℃ |
| Kokepunkt |
141°C at 760 mmHg |
| Flammepunktet |
61.6°C |
| Damptrykk |
3.42mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|