763-32-6 3-Methyl-3-buten-1-ol
| produktnavn |
3-Methyl-3-buten-1-ol |
| Engelsk navn |
3-Methyl-3-buten-1-ol;Isobutenylcarbinol; 2-Methyl-1-buten-4-ol; 3-Isopentenyl alcohol; Isoprenol; Isopropenylethyl alcohol; Methallylcarbinol; NSC 122673; 3-Buten-1-ol, 3-methyl-; 3-Methylbut-3-en-1-ol |
| Molekyl?r Formel |
C5H10O |
| Molekylvekt |
86.1323 |
| InChI |
InChI=1/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3 |
| CAS-nummer |
763-32-6 |
| EINECS |
212-110-8 |
| Molecular Structure |
|
| Tetthet |
0.832g/cm3 |
| Kokepunkt |
114.2°C at 760 mmHg |
| Brytningsindeks |
1.422 |
| Flammepunktet |
40.1°C |
| Damptrykk |
10.2mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R10:Flammable.;
R36:Irritating to eyes.;
|
| Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S24:Avoid contact with skin.;
|
|