4964-71-0 5-Bromo-quinoline
| produktnavn |
5-Bromo-quinoline |
| Engelsk navn |
5-Bromo-quinoline; 5-Bromoquinoline; RARECHEM AK ML 0010; 5-Bromoquinoline,97% |
| Molekyl?r Formel |
C9H6BrN |
| Molekylvekt |
208.0546 |
| InChI |
InChI=1/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
| CAS-nummer |
4964-71-0 |
| Molecular Structure |
|
| Tetthet |
1.564g/cm3 |
| Kokepunkt |
295.9°C at 760 mmHg |
| Brytningsindeks |
1.673 |
| Flammepunktet |
132.8°C |
| Damptrykk |
0.00261mmHg at 25°C |
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|