ChemNet > CAS > 4383-06-6 3-Hydroxy-4-methoxybenzyl alcohol
4383-06-6 3-Hydroxy-4-methoxybenzyl alcohol
| produktnavn |
3-Hydroxy-4-methoxybenzyl alcohol |
| Engelsk navn |
3-Hydroxy-4-methoxybenzyl alcohol; Isovanillyl alcohol; 5-(hydroxymethyl)-2-methoxyphenol |
| Molekyl?r Formel |
C8H10O3 |
| Molekylvekt |
154.1632 |
| InChI |
InChI=1/C8H10O3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,9-10H,5H2,1H3 |
| CAS-nummer |
4383-06-6 |
| EINECS |
224-489-7 |
| Molecular Structure |
|
| Tetthet |
1.226g/cm3 |
| Smeltepunkt |
135-137℃ |
| Kokepunkt |
315.8°C at 760 mmHg |
| Brytningsindeks |
1.57 |
| Flammepunktet |
144.8°C |
| Damptrykk |
0.00018mmHg at 25°C |
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S22:;
S24/25:;
|
|