4023-65-8 trans-Aconitic acid
| produktnavn |
trans-Aconitic acid |
| Engelsk navn |
trans-Aconitic acid; trans-Aconitic acid, (1,2,3-Propenetricarboxylic acid); (1E)-prop-1-ene-1,2,3-tricarboxylic acid; (1Z)-prop-1-ene-1,2,3-tricarboxylate |
| Molekyl?r Formel |
C6H3O6 |
| Molekylvekt |
171.0861 |
| InChI |
InChI=1/C6H6O6/c7-4(8)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,7,8)(H,9,10)(H,11,12)/p-3/b3-1- |
| CAS-nummer |
4023-65-8 |
| EINECS |
223-688-6 |
| Molecular Structure |
|
| Smeltepunkt |
190℃ |
| Kokepunkt |
542.6°C at 760 mmHg |
| Flammepunktet |
296°C |
| Damptrykk |
3.29E-13mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|