117-34-0 Diphenylacetic acid
| produktnavn |
Diphenylacetic acid |
| Engelsk navn |
Diphenylacetic acid; Benzeneacetic acid, alpha-phenyl-; 2,2-Diphenylacetic Acid |
| Molekyl?r Formel |
C14H12O2 |
| Molekylvekt |
212.2439 |
| InChI |
InChI=1/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| CAS-nummer |
117-34-0 |
| EINECS |
204-185-0 |
| Molecular Structure |
|
| Tetthet |
1.174g/cm3 |
| Smeltepunkt |
147-149℃ |
| Kokepunkt |
285°C at 760 mmHg |
| Brytningsindeks |
1.599 |
| Flammepunktet |
140.4°C |
| Damptrykk |
0.00135mmHg at 25°C |
| Hazard symboler |
Xi:Irritant;
|
| Risiko Koder |
R36/38:Irritating to eyes and skin.;
|
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|