102-38-5 3-Nitroformanilide
| produktnavn |
3-Nitroformanilide |
| Engelsk navn |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
| Molekyl?r Formel |
C7H6N2O3 |
| Molekylvekt |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| CAS-nummer |
102-38-5 |
| Molecular Structure |
|
| Tetthet |
1.407g/cm3 |
| Kokepunkt |
368.5°C at 760 mmHg |
| Brytningsindeks |
1.641 |
| Flammepunktet |
176.7°C |
| Damptrykk |
1.27E-05mmHg at 25°C |
| Risiko Koder |
R20/22:Harmful by inhalation and if swallowed.;
|
| Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|