923-06-8 DL-Bromosuccinic acid
| Naam product |
DL-Bromosuccinic acid |
| Engelse naam |
DL-Bromosuccinic acid; Bromobutanedioic acid; Bromosuccinic Acid; 2-bromobutanedioic acid; (2R)-2-bromobutanedioate; (2S)-2-bromobutanedioate; 2-Bromosuccinic acid |
| MF |
C4H3BrO4 |
| Molecuulgewicht |
194.9693 |
| InChI |
InChI=1/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/p-2/t2-/m0/s1 |
| CAS-nummer |
923-06-8 |
| EINECS |
213-087-7 |
| Moleculaire Structuur |
|
| Smeltpunt |
160-162℃ |
| Kookpunt |
255.1°C at 760 mmHg |
| Vlampunt |
108.1°C |
| Dampdruk |
0.00512mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|