ChemNet > CAS > 85-42-7 cis-1,2-Cyclohexanedicarboxylic anhydride
85-42-7;13149-00-3 cis-1,2-Cyclohexanedicarboxylic anhydride
| Naam product |
cis-1,2-Cyclohexanedicarboxylic anhydride |
| Engelse naam |
cis-1,2-Cyclohexanedicarboxylic anhydride; cis-Hexahydrophthalic anhydride; cis-HHPA; hexahydro-2-benzofuran-1,3-dione; (3aR,7aS)-hexahydro-2-benzofuran-1,3-dione; HHPA; Hexahydrophthalic anhydride; 1,2-Cyclohexanedicarboxylic anhydride; cyclohexanedicarboxylic anhydridel; 1,2-cyclohexane-dicarboxylic anhydride, mixture of cis and trans; Cyclohexane-1,2-dicarboxylic anhydride |
| MF |
C8H10O3 |
| Molecuulgewicht |
154.1632 |
| InChI |
InChI=1/C8H10O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h5-6H,1-4H2/t5-,6+ |
| CAS-nummer |
85-42-7;13149-00-3 |
| EINECS |
236-086-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.236g/cm3 |
| Smeltpunt |
29-32℃ |
| Kookpunt |
283.351°C at 760 mmHg |
| Brekingsindex |
1.502 |
| Vlampunt |
143.909°C |
| Dampdruk |
0.003mmHg at 25°C |
| Gevaarsymbolen |
Xn:Harmful;
|
| Risico-codes |
R41:Risks of serious damage to eyes.;
R42/43:May cause sensitization by inhalation and skin contact.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24:Avoid contact with skin.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|