ChemNet > CAS > 80166-90-1 5-Bromo-7-nitroindoline
80166-90-1 5-Bromo-7-nitroindoline
| Naam product |
5-Bromo-7-nitroindoline |
| Engelse naam |
5-Bromo-7-nitroindoline; 5-Bromo-7-Nitro-2,3-dihydro-1H-indole |
| MF |
C8H7BrN2O2 |
| Molecuulgewicht |
243.0574 |
| InChI |
InChI=1/C8H7BrN2O2/c9-6-3-5-1-2-10-8(5)7(4-6)11(12)13/h3-4,10H,1-2H2 |
| CAS-nummer |
80166-90-1 |
| EINECS |
279-411-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.704g/cm3 |
| Kookpunt |
344.2°C at 760 mmHg |
| Brekingsindex |
1.64 |
| Vlampunt |
162°C |
| Dampdruk |
6.67E-05mmHg at 25°C |
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|