ChemNet > CAS > 697-37-0 1-(1-Propynyl)cyclohexanol
697-37-0 1-(1-Propynyl)cyclohexanol
| Naam product |
1-(1-Propynyl)cyclohexanol |
| Engelse naam |
1-(1-Propynyl)cyclohexanol; 1-(Prop-1-yn-1-yl)cyclohexanol; cyclohexanol, 1-(1-propyn-1-yl)- |
| MF |
C9H14O |
| Molecuulgewicht |
138.2069 |
| InChI |
InChI=1/C9H14O/c1-2-6-9(10)7-4-3-5-8-9/h10H,3-5,7-8H2,1H3 |
| CAS-nummer |
697-37-0 |
| Moleculaire Structuur |
|
| Dichtheid |
0.98g/cm3 |
| Kookpunt |
221.7°C at 760 mmHg |
| Brekingsindex |
1.5 |
| Vlampunt |
95.7°C |
| Dampdruk |
0.0218mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|