4043-87-2;535-75-1 DL-Pipecolinic acid
| Naam product |
DL-Pipecolinic acid |
| Engelse naam |
DL-Pipecolinic acid; DL-2-Piperidinecarboxylic acid; DL-Pipecolic acid; H-DL-Homopro-OH; Pipecolinic acid; DL-Homoproline; (+/-)-2-Piperidinecarboxylic acid; 2-Piperidinecarboxylic acid; pipecolic acid; piperidine-2-carboxylic acid |
| MF |
C6H11NO2 |
| Molecuulgewicht |
129.16 |
| InChI |
InChI=1/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9) |
| CAS-nummer |
4043-87-2;535-75-1 |
| EINECS |
223-737-1;208-616-3 |
| Moleculaire Structuur |
|
| Smeltpunt |
282℃ |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|