33892-75-0 5-methoxy-1-tetralone
| Naam product |
5-methoxy-1-tetralone |
| Engelse naam |
5-methoxy-1-tetralone; 5-methoxy-1,2,3,4-tetrahydronaphthalen-1-one; 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one |
| MF |
C7H8BrN |
| Molecuulgewicht |
186.0491 |
| InChI |
InChI=1/C7H8BrN/c1-6-3-2-4-7(5-8)9-6/h2-4H,5H2,1H3 |
| CAS-nummer |
33892-75-0 |
| EINECS |
251-723-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.449g/cm3 |
| Smeltpunt |
87-91℃ |
| Kookpunt |
209.865°C at 760 mmHg |
| Brekingsindex |
1.565 |
| Vlampunt |
80.724°C |
| Dampdruk |
0.287mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|