ChemNet > CAS > 325-50-8 5-Fluoro-2-methylphenylhydrazine hydrochloride
325-50-8 5-Fluoro-2-methylphenylhydrazine hydrochloride
| Naam product |
5-Fluoro-2-methylphenylhydrazine hydrochloride |
| Engelse naam |
5-Fluoro-2-methylphenylhydrazine hydrochloride; (5-fluoro-2-methylphenyl)diazanium chloride; (5-fluoro-2-methylphenyl)hydrazine; 3-Fluoro-6-methylphenylhydrazine HCl; 5-Fluoro-2-methylphenylhydrazine HCl |
| MF |
C7H9FN2 |
| Molecuulgewicht |
140.1582 |
| InChI |
InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
| CAS-nummer |
325-50-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.202g/cm3 |
| Kookpunt |
212°C at 760 mmHg |
| Brekingsindex |
1.594 |
| Vlampunt |
82°C |
| Dampdruk |
0.177mmHg at 25°C |
| Risico-codes |
R20/22:Harmful by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|