3156-39-6 beta,2-Dinitrostyrene
| Naam product |
beta,2-Dinitrostyrene |
| Engelse naam |
beta,2-Dinitrostyrene; 2-Nitro-1-(2-nitrophenyl)ethene~2-Nitro-beta-nitrostyrene; 1-nitro-2-[(E)-2-nitroethenyl]benzene |
| MF |
C8H6N2O4 |
| Molecuulgewicht |
194.1442 |
| InChI |
InChI=1/C8H6N2O4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H/b6-5+ |
| CAS-nummer |
3156-39-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.401g/cm3 |
| Kookpunt |
356.6°C at 760 mmHg |
| Brekingsindex |
1.642 |
| Vlampunt |
183.3°C |
| Dampdruk |
5.93E-05mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|