3058-01-3 3-Methyladipic acid
| Naam product |
3-Methyladipic acid |
| Engelse naam |
3-Methyladipic acid; 3-Methylhexanedioic acid; (3S)-3-methylhexanedioate |
| MF |
C7H10O4 |
| Molecuulgewicht |
158.153 |
| InChI |
InChI=1/C7H12O4/c1-5(4-7(10)11)2-3-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/p-2/t5-/m0/s1 |
| CAS-nummer |
3058-01-3 |
| EINECS |
221-293-3 |
| Moleculaire Structuur |
|
| Smeltpunt |
95-97℃ |
| Kookpunt |
341.4°C at 760 mmHg |
| Vlampunt |
170.6°C |
| Dampdruk |
1.47E-05mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|