ChemNet > CAS > 2980-33-8 2-Hydroxy-3,5-dinitropyridine
2980-33-8 2-Hydroxy-3,5-dinitropyridine
| Naam product |
2-Hydroxy-3,5-dinitropyridine |
| Engelse naam |
2-Hydroxy-3,5-dinitropyridine; 3,5-Dinitro-2-pyridinol; 3,5-Dinitro-2-hydroxypyridine; 3,5-dinitropyridin-2(1H)-one; 5-nitro-6-oxo-1,6-dihydropyridine-3-carboxylic acid |
| MF |
C6H4N2O5 |
| Molecuulgewicht |
184.1064 |
| InChI |
InChI=1/C6H4N2O5/c9-5-4(8(12)13)1-3(2-7-5)6(10)11/h1-2H,(H,7,9)(H,10,11) |
| CAS-nummer |
2980-33-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.7g/cm3 |
| Kookpunt |
363.6°C at 760 mmHg |
| Brekingsindex |
1.634 |
| Vlampunt |
173.7°C |
| Dampdruk |
2.82E-06mmHg at 25°C |
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|