2396-84-1 ethyl sorbate
| Naam product |
ethyl sorbate |
| Engelse naam |
ethyl sorbate; Ethyl 2,4-hexadienoate~Sorbic acid ethyl ester; (E,E)-2,4-Hexadienoic acid ethylester; Ethyl trans,trans-2,4-hexadienoate; ethyl hexa-2,4-dienoate; ethyl (2E,4E)-hexa-2,4-dienoate; ethyl (2Z,4Z)-hexa-2,4-dienoate |
| MF |
C8H12O2 |
| Molecuulgewicht |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3,5-7H,4H2,1-2H3/b5-3-,7-6- |
| CAS-nummer |
2396-84-1 |
| EINECS |
219-258-2 |
| Moleculaire Structuur |
|
| Dichtheid |
0.926g/cm3 |
| Kookpunt |
195.5°C at 760 mmHg |
| Brekingsindex |
1.454 |
| Vlampunt |
69.4°C |
| Dampdruk |
0.418mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|