ChemNet > CAS > 21901-34-8 2-Hydroxy-5-nitro-3-picoline
21901-34-8 2-Hydroxy-5-nitro-3-picoline
| Naam product |
2-Hydroxy-5-nitro-3-picoline |
| Engelse naam |
2-Hydroxy-5-nitro-3-picoline;3-Methyl-5-nitro-2-pyridone; 3-Methyl-5-nitro-2-pyridinol; 2-Hydroxy-3-methyl-5-nitropyridine; 3-methyl-5-nitropyridin-2(1H)-one; 3-methyl-5-nitropyridin-2-ol |
| MF |
C6H6N2O3 |
| Molecuulgewicht |
154.1234 |
| InChI |
InChI=1/C6H6N2O3/c1-4-2-5(8(10)11)3-7-6(4)9/h2-3H,1H3,(H,7,9) |
| CAS-nummer |
21901-34-8 |
| EINECS |
244-647-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.36g/cm3 |
| Kookpunt |
327.2°C at 760 mmHg |
| Brekingsindex |
1.567 |
| Vlampunt |
151.7°C |
| Dampdruk |
0.000205mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|