ChemNet > CAS > 2157-56-4 2,4-Pentanedione dioxime
2157-56-4 2,4-Pentanedione dioxime
| Naam product |
2,4-Pentanedione dioxime |
| Engelse naam |
2,4-Pentanedione dioxime; Acetylacetone dioxime; N,N'-dihydroxypentane-2,4-diimine; (2Z,4Z)-pentane-2,4-dione dioxime; (2Z,4E)-pentane-2,4-dione dioxime; (2Z)-pentane-2,4-dione dioxime |
| MF |
C5H10N2O2 |
| Molecuulgewicht |
130.1451 |
| InChI |
InChI=1/C5H10N2O2/c1-4(6-8)3-5(2)7-9/h8-9H,3H2,1-2H3/b6-4-,7-5u |
| CAS-nummer |
2157-56-4 |
| EINECS |
218-472-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.13g/cm3 |
| Smeltpunt |
146-148℃ |
| Kookpunt |
298.8°C at 760 mmHg |
| Brekingsindex |
1.486 |
| Vlampunt |
179.3°C |
| Dampdruk |
0.000294mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|