ChemNet > CAS > 19952-47-7 2-Amino-4-chlorobenzothiazole
19952-47-7 2-Amino-4-chlorobenzothiazole
| Naam product |
2-Amino-4-chlorobenzothiazole |
| Engelse naam |
2-Amino-4-chlorobenzothiazole; 4-chloro-1,3-benzothiazol-2-ylamine; 4-chlorobenzo[d]thiazol-2-amine; 4-chloro-1,3-benzothiazol-2-amine |
| MF |
C7H5ClN2S |
| Molecuulgewicht |
184.646 |
| InChI |
InChI=1/C7H5ClN2S/c8-4-2-1-3-5-6(4)10-7(9)11-5/h1-3H,(H2,9,10) |
| CAS-nummer |
19952-47-7 |
| EINECS |
243-439-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.532g/cm3 |
| Smeltpunt |
203-208℃ |
| Kookpunt |
344.3°C at 760 mmHg |
| Brekingsindex |
1.762 |
| Vlampunt |
162°C |
| Dampdruk |
6.65E-05mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|