ChemNet > CAS > 154607-01-9 4-Bromo-2-chlorobenzonitrile
154607-01-9 4-Bromo-2-chlorobenzonitrile
| Naam product |
4-Bromo-2-chlorobenzonitrile |
| Engelse naam |
4-Bromo-2-chlorobenzonitrile; 2-Chloro-4-Bromobenzonitrile |
| MF |
C7H3BrClN |
| Molecuulgewicht |
216.4624 |
| InChI |
InChI=1/C7H3BrClN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| CAS-nummer |
154607-01-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.74g/cm3 |
| Kookpunt |
279.8°C at 760 mmHg |
| Brekingsindex |
1.623 |
| Vlampunt |
123°C |
| Dampdruk |
0.00393mmHg at 25°C |
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|