14309-57-0 3-Nonen-2-one
| Naam product |
3-Nonen-2-one |
| Engelse naam |
3-Nonen-2-one;non-3-en-2-one; (3E)-non-3-en-2-one; (3Z)-non-3-en-2-one |
| MF |
C9H16O |
| Molecuulgewicht |
140.2227 |
| InChI |
InChI=1/C9H16O/c1-3-4-5-6-7-8-9(2)10/h7-8H,3-6H2,1-2H3/b8-7- |
| CAS-nummer |
14309-57-0 |
| EINECS |
238-248-9 |
| Moleculaire Structuur |
|
| Dichtheid |
0.835g/cm3 |
| Kookpunt |
201.9°C at 760 mmHg |
| Brekingsindex |
1.435 |
| Vlampunt |
81.3°C |
| Dampdruk |
0.301mmHg at 25°C |
| Risico-codes |
R36/37:Irritating to eyes and respiratory system.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|