79-15-2 N-bromoacetamide
| Nama produk |
N-bromoacetamide |
| Nama Inggeris |
N-bromoacetamide;N-Bromoacetamide; CCRIS 4590; Acetamide, N-bromo- |
| MF |
C2H4BrNO |
| Berat Molekul |
137.9633 |
| InChI |
InChI=1/C2H4BrNO/c1-2(5)4-3/h1H3,(H,4,5) |
| CAS NO |
79-15-2 |
| EINECS |
201-181-0 |
| Struktur Molekul |
|
| Kepadatan |
1.71g/cm3 |
| Indeks bias |
1.474 |
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|