3333-67-3;16337-84-1;17301-01-8 nickel carbonate
| Nama produk |
nickel carbonate |
| Nama Inggeris |
nickel carbonate; Nickel (II) carbonate, anhydrous; Nickel(II) carbonate; C.I. 77779; Nickel aminosulphonate |
| MF |
NiCO3 |
| Berat Molekul |
118.7034 |
| InChI |
InChI=1/CH2O3.Ni/c2-1(3)4;/h(H2,2,3,4);/p-2 |
| CAS NO |
3333-67-3;16337-84-1;17301-01-8 |
| EINECS |
222-068-2 |
| Struktur Molekul |
|
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
R43:May cause sensitization by skin contact.;
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|