ChemNet > CAS > 18115-70-3 Lithium acetylacetonate
18115-70-3 Lithium acetylacetonate
| Nama produk |
Lithium acetylacetonate |
| Nama Inggeris |
Lithium acetylacetonate; Lithium 2,4-pentanedionate; lithium (2Z)-4-oxopent-2-en-2-olate; 2,4-pentanedione, lithium salt (1:1); Lithium Acetylacetone; Lithium Acetylacetone |
| MF |
C5H8LiO2 |
| Berat Molekul |
107.0563 |
| InChI |
InChI=1/C5H8O2.Li/c1-4(6)3-5(2)7;/h3H2,1-2H3;/q;+1 |
| CAS NO |
18115-70-3 |
| EINECS |
242-008-9 |
| Struktur Molekul |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R63:Possible risk of harm to the unborn child.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|