ChemNet > CAS > 9011-16-9 Methyl vinyl ether/maleic anhydride copolymer
9011-16-9 Methyl vinyl ether/maleic anhydride copolymer
| ???? |
Methyl vinyl ether/maleic anhydride copolymer |
| ?? ?? |
Methyl vinyl ether/maleic anhydride copolymer; Poly(methyl vinyl ether-alt-maleic anhydride); PVM/MA; Copolymer of Methyl Vinyl Ether/Maleic Anhydride; PVM/MA Copolymer; Poly(methyl vinyl ether/maleic anhydride) copolymer |
| ??? |
C7H8O4 |
| ??? |
156.136 |
| InChI |
InChI=1/C4H2O3.C3H6O/c5-3-1-2-4(6)7-3;1-3-4-2/h1-2H;3H,1H2,2H3 |
| cas?? |
9011-16-9 |
| ?? ?? |
|
| ??? |
202°C at 760 mmHg |
| ??? |
103.3°C |
| ??? |
0.299mmHg at 25°C |
| ?? ?? |
S24/25:Avoid contact with skin and eyes.;
|
|