ChemNet > CAS > 6705-03-9 2-Amino-5-methoxybenzoic acid
6705-03-9 2-Amino-5-methoxybenzoic acid
| ???? |
2-Amino-5-methoxybenzoic acid |
| ?? ?? |
2-Amino-5-methoxybenzoic acid; 5-Methoxyanthranilic acid; 2-Amino-5-methoxy-benzoic acid |
| ??? |
C8H8N2O |
| ??? |
148.1619 |
| InChI |
InChI=1/C8H8N2O/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4H,10H2,1H3 |
| cas?? |
6705-03-9 |
| ?? ?? |
|
| ?? |
1.17g/cm3 |
| ?? ? |
148-152℃ |
| ??? |
302.2°C at 760 mmHg |
| ?? ?? |
1.569 |
| ??? |
136.6°C |
| ??? |
0.00101mmHg at 25°C |
| ??? ?? |
Xn:Harmful;
|
| ??? ?? |
R22:;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|