ChemNet > CAS > 31680-07-6 Methylnitrobenzaldehyde
31680-07-6 Methylnitrobenzaldehyde
| ???? |
Methylnitrobenzaldehyde |
| ?? ?? |
Methylnitrobenzaldehyde; 4-Methyl-3-nitrobenzaldehyde; Benzaldehyde, 4-methyl-3-nitro-; WLN IS WNR B1 EVH [WLN] |
| ??? |
C8H7NO3 |
| ??? |
165.1461 |
| InChI |
InChI=1/C8H7NO3/c1-6-2-3-7(5-10)4-8(6)9(11)12/h2-5H,1H3 |
| cas?? |
31680-07-6 |
| EC?? |
250-760-4 |
| ?? ?? |
|
| ?? |
1.278g/cm3 |
| ?? ? |
43-54℃ |
| ??? |
276.3°C at 760 mmHg |
| ?? ?? |
1.602 |
| ??? |
130.1°C |
| ??? |
0.00485mmHg at 25°C |
| ??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|