2905-56-8 1-Benzylpiperidine
| ???? |
1-Benzylpiperidine |
| ?? ?? |
1-Benzylpiperidine; N-benzylpiperidine; 1-benzylpiperidine hydrochloride (1:1) |
| ??? |
C12H18ClN |
| ??? |
211.731 |
| InChI |
InChI=1/C12H17N.ClH/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1,3-4,7-8H,2,5-6,9-11H2;1H |
| cas?? |
2905-56-8 |
| EC?? |
220-809-4 |
| ?? ?? |
|
| ??? |
246.6°C at 760 mmHg |
| ??? |
94°C |
| ??? |
0.0269mmHg at 25°C |
| ??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|