878-00-2 4-Acetoxybenzaldehyde
| Nome del prodotto |
4-Acetoxybenzaldehyde |
| Nome inglese |
4-Acetoxybenzaldehyde; 4-Formylphenyl acetate |
| Formula molecolare |
C9H8O3 |
| Peso Molecolare |
164.158 |
| InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
| Numero CAS |
878-00-2 |
| EINECS |
212-898-3 |
| Struttura molecolare |
|
| Densità |
1.183g/cm3 |
| Punto di ebollizione |
275°C at 760 mmHg |
| Indice di rifrazione |
1.552 |
| Punto d'infiammabilità |
119.4°C |
| Pressione di vapore |
0.00522mmHg at 25°C |
| Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|