540-08-9 heptadecan-9-one
| Nome del prodotto |
heptadecan-9-one |
| Nome inglese |
heptadecan-9-one; 9-Heptadecanone; Di-n-octyl ketone~Pelargone |
| Formula molecolare |
C17H34O |
| Peso Molecolare |
254.4513 |
| InChI |
InChI=1/C17H34O/c1-3-5-7-9-11-13-15-17(18)16-14-12-10-8-6-4-2/h3-16H2,1-2H3 |
| Numero CAS |
540-08-9 |
| EINECS |
208-734-5 |
| Struttura molecolare |
|
| Densità |
0.83g/cm3 |
| Punto di ebollizione |
322.7°C at 760 mmHg |
| Indice di rifrazione |
1.44 |
| Punto d'infiammabilità |
83.6°C |
| Pressione di vapore |
0.000275mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|