513-85-9;123513-85-9 butane-2,3-diol
| Nome del prodotto |
butane-2,3-diol |
| Nome inglese |
butane-2,3-diol; 2,3-Butanediol; 2,3-Dihydroxybutane; 2,3-Butanediol, mixture of DL and meso; 2,3-butylene glycol; (2R,3S)-butane-2,3-diol |
| Formula molecolare |
C4H10O2 |
| Peso Molecolare |
90.121 |
| InChI |
InChI=1/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3 |
| Numero CAS |
513-85-9;123513-85-9 |
| EINECS |
208-173-6 |
| Struttura molecolare |
|
| Densità |
0.997g/cm3 |
| Punto di fusione |
25℃ |
| Punto di ebollizione |
180.7°C at 760 mmHg |
| Indice di rifrazione |
1.434 |
| Punto d'infiammabilità |
85°C |
| Solubilità in acqua |
SOLUBLE |
| Pressione di vapore |
0.26mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:;
|
|