ChemNet > CAS > 502-85-2 4-Hydroxybutyric acid, sodium salt
502-85-2 4-Hydroxybutyric acid, sodium salt
| Nome del prodotto |
4-Hydroxybutyric acid, sodium salt |
| Nome inglese |
4-Hydroxybutyric acid, sodium salt; Sodium Oxybate; 4-Hydroxybutyric acid sodium salt; Sodium 4-hydroxybutyrate; Gamma-Hydroxybutyrate Sodium Salt; sodium 4-hydroxybutanoate |
| Formula molecolare |
C4H7NaO3 |
| Peso Molecolare |
126.0863 |
| InChI |
InChI=1/C4H8O3.Na/c5-3-1-2-4(6)7;/h5H,1-3H2,(H,6,7);/q;+1/p-1 |
| Numero CAS |
502-85-2 |
| EINECS |
207-953-3 |
| Struttura molecolare |
|
| Punto di fusione |
143-147℃ |
| Punto di ebollizione |
295.6°C at 760 mmHg |
| Punto d'infiammabilità |
146.8°C |
| Pressione di vapore |
0.000156mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|