497-36-9 endo-(±)-norborneolo
| Nome del prodotto |
endo-(±)-norborneolo |
| Sinonimi |
; endo-(?-2-Norbornanolo;( 1R,2S,4S)-biciclo[2.2.1]eptan-2-olo |
| Nome inglese |
endo-(±)-Norborneol; endo-(?-2-Norbornanol; (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol |
| Formula molecolare |
C7H12O |
| Peso Molecolare |
112.1696 |
| InChI |
InChI=1/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m0/s1 |
| Numero CAS |
497-36-9 |
| EINECS |
207-844-0 |
| Struttura molecolare |
|
| Densità |
1.098g/cm3 |
| Punto di fusione |
148-154℃ |
| Punto di ebollizione |
176.499°C at 760 mmHg |
| Indice di rifrazione |
1.537 |
| Punto d'infiammabilità |
74.376°C |
| Pressione di vapore |
0.332mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|