497-36-9 endo-(±)-Norborneol
| Nama produk |
endo-(±)-Norborneol |
| Sinonim |
; endo-(?-2-Norbornanol;( 1R,2S,4S)-bisiklo[2.2.1]heptan-2-ol |
| Nama bahasa Inggris |
endo-(±)-Norborneol; endo-(?-2-Norbornanol; (1R,2S,4S)-bicyclo[2.2.1]heptan-2-ol |
| MF |
C7H12O |
| Berat Molekul |
112.1696 |
| InChI |
InChI=1/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m0/s1 |
| CAS NO |
497-36-9 |
| EINECS |
207-844-0 |
| Struktur Molekul |
|
| Kepadatan |
1.098g/cm3 |
| Titik lebur |
148-154℃ |
| Titik didih |
176.499°C at 760 mmHg |
| Indeks bias |
1.537 |
| Titik nyala |
74.376°C |
| Tekanan uap |
0.332mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|