ChemNet > CAS > 394-28-5 2-Bromo-5-Fluorobenzoic Acid
394-28-5 2-Bromo-5-Fluorobenzoic Acid
| Nome del prodotto |
2-Bromo-5-Fluorobenzoic Acid |
| Nome inglese |
2-Bromo-5-Fluorobenzoic Acid; 2-Bromo-5-fluorobenzoic acid,98%; 2-bromo-5-fluorobenzoicacid,98%; RARECHEM AL BO 0747; BUTTPARK 19\01-66; 2-Bromo-5-Fluorobenzoic; 2-Bromo-5-fluorobenzoic acid 98%; 2-bromo-5-fluorobenzoate |
| Formula molecolare |
C7H3BrFO2 |
| Peso Molecolare |
218.0005 |
| InChI |
InChI=1/C7H4BrFO2/c8-6-2-1-4(9)3-5(6)7(10)11/h1-3H,(H,10,11)/p-1 |
| Numero CAS |
394-28-5 |
| Struttura molecolare |
|
| Punto di fusione |
154-157℃ |
| Punto di ebollizione |
291.1°C at 760 mmHg |
| Punto d'infiammabilità |
129.8°C |
| Pressione di vapore |
0.000915mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|