ChemNet > CAS > 3469-26-9 2,7-Dimethoxynaphthalene
3469-26-9 2,7-Dimethoxynaphthalene
| Nome del prodotto |
2,7-Dimethoxynaphthalene |
| Nome inglese |
2,7-Dimethoxynaphthalene; 2,7-dimethoxyl Naphthalene |
| Formula molecolare |
C12H12O2 |
| Peso Molecolare |
188.2225 |
| InChI |
InChI=1/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3 |
| Numero CAS |
3469-26-9 |
| EINECS |
222-433-6 |
| Struttura molecolare |
|
| Densità |
1.097g/cm3 |
| Punto di fusione |
137-139℃ |
| Punto di ebollizione |
311.2°C at 760 mmHg |
| Indice di rifrazione |
1.584 |
| Punto d'infiammabilità |
130.3°C |
| Pressione di vapore |
0.00105mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|