2657-25-2 4'-Hydroxychalcone
| Nome del prodotto |
4'-Hydroxychalcone |
| Nome inglese |
4'-Hydroxychalcone; Benzylidene-(4-hydroxyacetophenone); 1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one; (2E)-1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one |
| Formula molecolare |
C15H12O2 |
| Peso Molecolare |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-7-13(8-10-14)15(17)11-6-12-4-2-1-3-5-12/h1-11,16H/b11-6+ |
| Numero CAS |
2657-25-2 |
| Struttura molecolare |
|
| Densità |
1.191g/cm3 |
| Punto di ebollizione |
419.6°C at 760 mmHg |
| Indice di rifrazione |
1.653 |
| Punto d'infiammabilità |
179.1°C |
| Pressione di vapore |
1.23E-07mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|