ChemNet > CAS > 2460-59-5 3,5-Dinitro-2-hydroxybenzaldehyde
2460-59-5 3,5-Dinitro-2-hydroxybenzaldehyde
| Nome del prodotto |
3,5-Dinitro-2-hydroxybenzaldehyde |
| Nome inglese |
3,5-Dinitro-2-hydroxybenzaldehyde; 3,5-Dinitrosalicylaldehyde; 2-hydroxy-3,5-dinitrobenzaldehyde; 2-formyl-4,6-dinitrophenolate |
| Formula molecolare |
C7H3N2O6 |
| Peso Molecolare |
211.1091 |
| InChI |
InChI=1/C7H4N2O6/c10-3-4-1-5(8(12)13)2-6(7(4)11)9(14)15/h1-3,11H/p-1 |
| Numero CAS |
2460-59-5 |
| EINECS |
219-551-5 |
| Struttura molecolare |
|
| Punto di ebollizione |
301.5°C at 760 mmHg |
| Punto d'infiammabilità |
133.3°C |
| Pressione di vapore |
0.000585mmHg at 25°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|